C18H27N3O2S2 — CID 47030902
1-(pyrrolidine-1-carbonyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide (PubChem CID 47030902) has the molecular formula C18H27N3O2S2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 1-(pyrrolidine-1-carbonyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(pyrrolidine-1-carbonyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47030902 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-(pyrrolidine-1-carbonyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1cccs1)C1CCCN(C(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C18H27N3O2S2/c22-17(19-7-12-24-14-16-6-4-11-25-16)15-5-3-10-21(13-15)18(23)20-8-1-2-9-20/h4,6,11,15H,1-3,5,7-10,12-14H2,(H,19,22) |
| InChIKey | ZSLPUOKKDVCCNY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|