C19H24N2O3S3 — CID 46819848
3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 46819848) has the molecular formula C19H24N2O3S3 and a molecular weight of 424.61 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46819848 |
| Molecular Formula | C19H24N2O3S3 |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCc1cccs1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H24N2O3S3/c22-19(20-9-13-25-15-17-7-5-12-26-17)16-6-4-8-18(14-16)27(23,24)21-10-2-1-3-11-21/h4-8,12,14H,1-3,9-11,13,15H2,(H,20,22) |
| InChIKey | WGZAQDNJDKXUMH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|