C16H26N2O3S2 — CID 55524372
3-piperidin-1-ylsulfonyl-N,N-dipropylthiophene-2-carboxamide (PubChem CID 55524372) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N,N-dipropylthiophene-2-carboxamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N,N-dipropylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55524372 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N,N-dipropylthiophene-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H26N2O3S2/c1-3-9-17(10-4-2)16(19)15-14(8-13-22-15)23(20,21)18-11-6-5-7-12-18/h8,13H,3-7,9-12H2,1-2H3 |
| InChIKey | XVHNTHVIELVXNY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |