C18H21FN2O3S2 — CID 32886702
N-[(2-fluorophenyl)methyl]-N-methyl-3-piperidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 32886702) has the molecular formula C18H21FN2O3S2 and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-methyl-3-piperidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-methyl-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 32886702 |
| Molecular Formula | C18H21FN2O3S2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-methyl-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | CN(Cc1ccccc1F)C(=O)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H21FN2O3S2/c1-20(13-14-7-3-4-8-15(14)19)18(22)17-16(9-12-25-17)26(23,24)21-10-5-2-6-11-21/h3-4,7-9,12H,2,5-6,10-11,13H2,1H3 |
| InChIKey | BILRDIZMYVZNGD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |