C17H22N2O4S2 — CID 43051837
N-methyl-N-[(5-methylfuran-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 43051837) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-methyl-N-[(5-methylfuran-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 43051837 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2sccc2S(=O)(=O)N2CCCCC2)o1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-13-6-7-14(23-13)12-18(2)17(20)16-15(8-11-24-16)25(21,22)19-9-4-3-5-10-19/h6-8,11H,3-5,9-10,12H2,1-2H3 |
| InChIKey | FSXXDMHJNUVLGZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |