C15H16N2O6S2 — CID 119246200
5-[[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 119246200) has the molecular formula C15H16N2O6S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-[[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 119246200 |
| Molecular Formula | C15H16N2O6S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 5-[[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2sccc2S(=O)(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C15H16N2O6S2/c18-14(16-9-10-3-4-11(23-10)15(19)20)13-12(5-8-24-13)25(21,22)17-6-1-2-7-17/h3-5,8H,1-2,6-7,9H2,(H,16,18)(H,19,20) |
| InChIKey | DJVXIUNAFMXVRZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |