C12H18N2O5S — CID 75356375
5-[(azepan-1-ylsulfonylamino)methyl]furan-2-carboxylic acid (PubChem CID 75356375) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 5-[(azepan-1-ylsulfonylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(azepan-1-ylsulfonylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 75356375 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[(azepan-1-ylsulfonylamino)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNS(=O)(=O)N2CCCCCC2)o1 |
| InChI | InChI=1S/C12H18N2O5S/c15-12(16)11-6-5-10(19-11)9-13-20(17,18)14-7-3-1-2-4-8-14/h5-6,13H,1-4,7-9H2,(H,15,16) |
| InChIKey | GBXWRYNVFGENQW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |