C10H11N3O5S — CID 104709706
5-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]furan-2-carboxylic acid (PubChem CID 104709706) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 104709706 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]furan-2-carboxylic acid |
| SMILES | Cn1nccc1S(=O)(=O)NCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C10H11N3O5S/c1-13-9(4-5-11-13)19(16,17)12-6-7-2-3-8(18-7)10(14)15/h2-5,12H,6H2,1H3,(H,14,15) |
| InChIKey | QJGUOZTXAIJSLS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |