C8H11NO7S2 — CID 82839821
5-[(methylsulfonylmethylsulfonylamino)methyl]furan-2-carboxylic acid (PubChem CID 82839821) has the molecular formula C8H11NO7S2 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-[(methylsulfonylmethylsulfonylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(methylsulfonylmethylsulfonylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82839821 |
| Molecular Formula | C8H11NO7S2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 5-[(methylsulfonylmethylsulfonylamino)methyl]furan-2-carboxylic acid |
| SMILES | CS(=O)(=O)CS(=O)(=O)NCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H11NO7S2/c1-17(12,13)5-18(14,15)9-4-6-2-3-7(16-6)8(10)11/h2-3,9H,4-5H2,1H3,(H,10,11) |
| InChIKey | OMTPBEAFCGFCBS-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |