C9H14N2O5S — CID 55203550
5-[[2-(methanesulfonamido)ethylamino]methyl]furan-2-carboxylic acid (PubChem CID 55203550) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is 5-[[2-(methanesulfonamido)ethylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-(methanesulfonamido)ethylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 55203550 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-[[2-(methanesulfonamido)ethylamino]methyl]furan-2-carboxylic acid |
| SMILES | CS(=O)(=O)NCCNCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C9H14N2O5S/c1-17(14,15)11-5-4-10-6-7-2-3-8(16-7)9(12)13/h2-3,10-11H,4-6H2,1H3,(H,12,13) |
| InChIKey | NJDLWRFAHRGTDM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|