C11H17NO5 — CID 106305544
5-[[3-(2-hydroxyethoxy)propylamino]methyl]furan-2-carboxylic acid (PubChem CID 106305544) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 5-[[3-(2-hydroxyethoxy)propylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-(2-hydroxyethoxy)propylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106305544 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-[[3-(2-hydroxyethoxy)propylamino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNCCCOCCO)o1 |
| InChI | InChI=1S/C11H17NO5/c13-5-7-16-6-1-4-12-8-9-2-3-10(17-9)11(14)15/h2-3,12-13H,1,4-8H2,(H,14,15) |
| InChIKey | ZWFWHDSSCFJCBJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|