C11H17NO4S — CID 106305535
3-[[3-(2-hydroxyethoxy)propylamino]methyl]thiophene-2-carboxylic acid (PubChem CID 106305535) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-[[3-(2-hydroxyethoxy)propylamino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[3-(2-hydroxyethoxy)propylamino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106305535 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-[[3-(2-hydroxyethoxy)propylamino]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1CNCCCOCCO |
| InChI | InChI=1S/C11H17NO4S/c13-4-6-16-5-1-3-12-8-9-2-7-17-10(9)11(14)15/h2,7,12-13H,1,3-6,8H2,(H,14,15) |
| InChIKey | XOVAUNKCESRWNF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|