C9H13NO3S — CID 103230956
3-[(2-methoxyethylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103230956) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-[(2-methoxyethylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2-methoxyethylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103230956 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-[(2-methoxyethylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | COCCNCc1ccsc1C(=O)O |
| InChI | InChI=1S/C9H13NO3S/c1-13-4-3-10-6-7-2-5-14-8(7)9(11)12/h2,5,10H,3-4,6H2,1H3,(H,11,12) |
| InChIKey | RQLXWWFWZJHJFQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|