3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid

C11H17NO2S — CID 103249040

IUPAC3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid
SMILESCCC(C)CNCc1ccsc1C(=O)O
InChIInChI=1S/C11H17NO2S/c1-3-8(2)6-12-7-9-4-5-15-10(9)11(13)14/h4-5,8,12H,3,6-7H2,1-2H3,(H,13,14)
InChIKeyPLBKPIWRSLLTMG-UHFFFAOYSA-N
MW227.33 g/mol
LogP2.58
Rot. Bonds6

About 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid

3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103249040) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid.

Molecular Properties

Compound Name3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid
PubChem CID103249040
Molecular FormulaC11H17NO2S
Molecular Weight227.33 g/mol
Exact Mass227.10
IUPAC Name3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid
SMILESCCC(C)CNCc1ccsc1C(=O)O
InChIInChI=1S/C11H17NO2S/c1-3-8(2)6-12-7-9-4-5-15-10(9)11(13)14/h4-5,8,12H,3,6-7H2,1-2H3,(H,13,14)
InChIKeyPLBKPIWRSLLTMG-UHFFFAOYSA-N
XLogP2.58
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.33
LogP ≤ 52.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid?
The IUPAC name of 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid (CID 103249040) is 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid?
The canonical SMILES for 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid is CCC(C)CNCc1ccsc1C(=O)O.
What is the InChIKey of 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid?
The InChIKey is PLBKPIWRSLLTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-3-8(2)6-12-7-9-4-5-15-10(9)11(13)14/h4-5,8,12H,3,6-7H2,1-2H3,(H,13,14).
What are the key properties of 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid?
3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid has a molecular weight of 227.33 g/mol, XLogP of 2.58, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylbutylamino)methyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 103249040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).