C14H22N2O5 — CID 107241247
5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]furan-2-carboxylic acid (PubChem CID 107241247) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107241247 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCNCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C14H22N2O5/c1-14(2,3)21-13(19)16-8-4-7-15-9-10-5-6-11(20-10)12(17)18/h5-6,15H,4,7-9H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | MHEIELLHQLZXIV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|