C12H17NO5 — CID 81462245
5-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 81462245) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 5-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 81462245 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CNCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H17NO5/c1-12(2,3)18-10(14)7-13-6-8-4-5-9(17-8)11(15)16/h4-5,13H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | LPTCILBKOZBURY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |