About 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid
5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 106143516) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid |
| PubChem CID | 106143516 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | CC(C)(CCO)CNCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H19NO4/c1-12(2,5-6-14)8-13-7-9-3-4-10(17-9)11(15)16/h3-4,13-14H,5-8H2,1-2H3,(H,15,16) |
| InChIKey | YXNRJLSQGCQULZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid?
The IUPAC name of 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid (CID 106143516) is 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid is CC(C)(CCO)CNCc1ccc(C(=O)O)o1.
What is the InChIKey of 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid?
The InChIKey is YXNRJLSQGCQULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO4/c1-12(2,5-6-14)8-13-7-9-3-4-10(17-9)11(15)16/h3-4,13-14H,5-8H2,1-2H3,(H,15,16).
What are the key properties of 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid?
5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid has a molecular weight of 241.29 g/mol, XLogP of 1.48, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(4-hydroxy-2,2-dimethylbutyl)amino]methyl]furan-2-carboxylic acid is sourced from PubChem (CID 106143516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).