C12H20BrNO2 — CID 103527615
5-[(5-bromofuran-2-yl)methylamino]-4,4-dimethylpentan-1-ol (PubChem CID 103527615) has the molecular formula C12H20BrNO2 and a molecular weight of 290.20 g/mol. Its IUPAC name is 5-[(5-bromofuran-2-yl)methylamino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(5-bromofuran-2-yl)methylamino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 103527615 |
| Molecular Formula | C12H20BrNO2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-[(5-bromofuran-2-yl)methylamino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNCc1ccc(Br)o1 |
| InChI | InChI=1S/C12H20BrNO2/c1-12(2,6-3-7-15)9-14-8-10-4-5-11(13)16-10/h4-5,14-15H,3,6-9H2,1-2H3 |
| InChIKey | KYABIKJNQSHOPQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |