C12H21BrN2O — CID 115572727
N-[(5-bromofuran-2-yl)methyl]-N'-tert-butylpropane-1,3-diamine (PubChem CID 115572727) has the molecular formula C12H21BrN2O and a molecular weight of 289.22 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-N'-tert-butylpropane-1,3-diamine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-N'-tert-butylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115572727 |
| Molecular Formula | C12H21BrN2O |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-N'-tert-butylpropane-1,3-diamine |
| SMILES | CC(C)(C)NCCCNCc1ccc(Br)o1 |
| InChI | InChI=1S/C12H21BrN2O/c1-12(2,3)15-8-4-7-14-9-10-5-6-11(13)16-10/h5-6,14-15H,4,7-9H2,1-3H3 |
| InChIKey | ACDKVXDSERNSJJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|