C11H19BrN2O2 — CID 103527551
1-[(5-bromofuran-2-yl)methylamino]-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 103527551) has the molecular formula C11H19BrN2O2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methylamino]-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[(5-bromofuran-2-yl)methylamino]-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 103527551 |
| Molecular Formula | C11H19BrN2O2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methylamino]-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | CN(C)CC(C)(O)CNCc1ccc(Br)o1 |
| InChI | InChI=1S/C11H19BrN2O2/c1-11(15,8-14(2)3)7-13-6-9-4-5-10(12)16-9/h4-5,13,15H,6-8H2,1-3H3 |
| InChIKey | STTTYTLFSDENFY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |