C11H18BrNO2 — CID 106186158
3-[(5-bromofuran-2-yl)methylamino]-2,3-dimethylbutan-2-ol (PubChem CID 106186158) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is 3-[(5-bromofuran-2-yl)methylamino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(5-bromofuran-2-yl)methylamino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 106186158 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-[(5-bromofuran-2-yl)methylamino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCc1ccc(Br)o1 |
| InChI | InChI=1S/C11H18BrNO2/c1-10(2,11(3,4)14)13-7-8-5-6-9(12)15-8/h5-6,13-14H,7H2,1-4H3 |
| InChIKey | YLDGFGVSHLJJOT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |