C10H15BrN2O2 — CID 60926484
3-[(5-bromofuran-2-yl)methylamino]-N,N-dimethylpropanamide (PubChem CID 60926484) has the molecular formula C10H15BrN2O2 and a molecular weight of 275.15 g/mol. Its IUPAC name is 3-[(5-bromofuran-2-yl)methylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(5-bromofuran-2-yl)methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60926484 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 3-[(5-bromofuran-2-yl)methylamino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNCc1ccc(Br)o1 |
| InChI | InChI=1S/C10H15BrN2O2/c1-13(2)10(14)5-6-12-7-8-3-4-9(11)15-8/h3-4,12H,5-7H2,1-2H3 |
| InChIKey | MPRWIRFBIRYYSX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|