C11H18Cl2N2O2 — CID 115595769
4-[(5-chlorofuran-2-yl)methylamino]-N,N-dimethylbutanamide;hydrochloride (PubChem CID 115595769) has the molecular formula C11H18Cl2N2O2 and a molecular weight of 281.18 g/mol. Its IUPAC name is 4-[(5-chlorofuran-2-yl)methylamino]-N,N-dimethylbutanamide;hydrochloride.
| Compound Name | 4-[(5-chlorofuran-2-yl)methylamino]-N,N-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 115595769 |
| Molecular Formula | C11H18Cl2N2O2 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-[(5-chlorofuran-2-yl)methylamino]-N,N-dimethylbutanamide;hydrochloride |
| SMILES | CN(C)C(=O)CCCNCc1ccc(Cl)o1.Cl |
| InChI | InChI=1S/C11H17ClN2O2.ClH/c1-14(2)11(15)4-3-7-13-8-9-5-6-10(12)16-9;/h5-6,13H,3-4,7-8H2,1-2H3;1H |
| InChIKey | WCQIXNMHQOMXJE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|