C12H15BrF2N2O — CID 106263370
3-[(3-bromo-2,6-difluorophenyl)methylamino]-N,N-dimethylpropanamide (PubChem CID 106263370) has the molecular formula C12H15BrF2N2O and a molecular weight of 321.17 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 106263370 |
| Molecular Formula | C12H15BrF2N2O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methylamino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H15BrF2N2O/c1-17(2)11(18)5-6-16-7-8-10(14)4-3-9(13)12(8)15/h3-4,16H,5-7H2,1-2H3 |
| InChIKey | VBGHDEDZUHBECQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|