C13H18BrF2NS — CID 106263898
N-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine (PubChem CID 106263898) has the molecular formula C13H18BrF2NS and a molecular weight of 338.26 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine |
|---|---|
| PubChem CID | 106263898 |
| Molecular Formula | C13H18BrF2NS |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine |
| SMILES | CSCCCCCNCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H18BrF2NS/c1-18-8-4-2-3-7-17-9-10-12(15)6-5-11(14)13(10)16/h5-6,17H,2-4,7-9H2,1H3 |
| InChIKey | MEHWVCJABFIWFD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|