C13H19F2NS — CID 104923249
N-[(2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine (PubChem CID 104923249) has the molecular formula C13H19F2NS and a molecular weight of 259.37 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine |
|---|---|
| PubChem CID | 104923249 |
| Molecular Formula | C13H19F2NS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-5-methylsulfanylpentan-1-amine |
| SMILES | CSCCCCCNCc1c(F)cccc1F |
| InChI | InChI=1S/C13H19F2NS/c1-17-9-4-2-3-8-16-10-11-12(14)6-5-7-13(11)15/h5-7,16H,2-4,8-10H2,1H3 |
| InChIKey | IJNIITFGUOTGGB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|