C13H18BrF2N — CID 106263475
N-[(3-bromo-2,6-difluorophenyl)methyl]hexan-1-amine (PubChem CID 106263475) has the molecular formula C13H18BrF2N and a molecular weight of 306.19 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]hexan-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 106263475 |
| Molecular Formula | C13H18BrF2N |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H18BrF2N/c1-2-3-4-5-8-17-9-10-12(15)7-6-11(14)13(10)16/h6-7,17H,2-5,8-9H2,1H3 |
| InChIKey | YZEULBFGCGUIMQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|