C9H11BrF2N2 — CID 106263667
2-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dimethylhydrazine (PubChem CID 106263667) has the molecular formula C9H11BrF2N2 and a molecular weight of 265.10 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 106263667 |
| Molecular Formula | C9H11BrF2N2 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C9H11BrF2N2/c1-14(2)13-5-6-8(11)4-3-7(10)9(6)12/h3-4,13H,5H2,1-2H3 |
| InChIKey | ZUBDHNGLABFKFP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|