About 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide
3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide (PubChem CID 62083451) has the molecular formula C12H18Br2N2O2
and a molecular weight of 382.10 g/mol. Its IUPAC name is 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide |
| PubChem CID | 62083451 |
| Molecular Formula | C12H18Br2N2O2 |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C12H18Br2N2O2/c1-3-16(4-2)11(17)5-6-15-8-9-7-10(13)12(14)18-9/h7,15H,3-6,8H2,1-2H3 |
| InChIKey | SCTCTDXTBQOFNI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide?
The IUPAC name of 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide (CID 62083451) is 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide.
What is the SMILES notation for 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide?
The canonical SMILES for 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide is CCN(CC)C(=O)CCNCc1cc(Br)c(Br)o1.
What is the InChIKey of 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide?
The InChIKey is SCTCTDXTBQOFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18Br2N2O2/c1-3-16(4-2)11(17)5-6-15-8-9-7-10(13)12(14)18-9/h7,15H,3-6,8H2,1-2H3.
What are the key properties of 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide?
3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide has a molecular weight of 382.10 g/mol, XLogP of 3.15, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide is sourced from PubChem (CID 62083451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).