C12H18Br2N2O2 — CID 62083451
3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide (PubChem CID 62083451) has the molecular formula C12H18Br2N2O2 and a molecular weight of 382.10 g/mol. Its IUPAC name is 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 62083451 |
| Molecular Formula | C12H18Br2N2O2 |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 3-[(4,5-dibromofuran-2-yl)methylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C12H18Br2N2O2/c1-3-16(4-2)11(17)5-6-15-8-9-7-10(13)12(14)18-9/h7,15H,3-6,8H2,1-2H3 |
| InChIKey | SCTCTDXTBQOFNI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|