C17H28N2O — CID 60925508
N,N-diethyl-3-[(2,4,5-trimethylphenyl)methylamino]propanamide (PubChem CID 60925508) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N,N-diethyl-3-[(2,4,5-trimethylphenyl)methylamino]propanamide.
| Compound Name | N,N-diethyl-3-[(2,4,5-trimethylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 60925508 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N,N-diethyl-3-[(2,4,5-trimethylphenyl)methylamino]propanamide |
| SMILES | CCN(CC)C(=O)CCNCc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C17H28N2O/c1-6-19(7-2)17(20)8-9-18-12-16-11-14(4)13(3)10-15(16)5/h10-11,18H,6-9,12H2,1-5H3 |
| InChIKey | LXEZYSQJPFVMQY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|