C19H32N2O2 — CID 107245427
tert-butyl N-ethyl-N-[2-[(2,4,5-trimethylphenyl)methylamino]ethyl]carbamate (PubChem CID 107245427) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-[(2,4,5-trimethylphenyl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-[(2,4,5-trimethylphenyl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 107245427 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-[(2,4,5-trimethylphenyl)methylamino]ethyl]carbamate |
| SMILES | CCN(CCNCc1cc(C)c(C)cc1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O2/c1-8-21(18(22)23-19(5,6)7)10-9-20-13-17-12-15(3)14(2)11-16(17)4/h11-12,20H,8-10,13H2,1-7H3 |
| InChIKey | HQPLOAMZHYKNQM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|