C16H24BrClN2O2 — CID 107245367
tert-butyl N-[2-[(4-bromo-2-chlorophenyl)methylamino]ethyl]-N-ethylcarbamate (PubChem CID 107245367) has the molecular formula C16H24BrClN2O2 and a molecular weight of 391.74 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-bromo-2-chlorophenyl)methylamino]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[(4-bromo-2-chlorophenyl)methylamino]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 107245367 |
| Molecular Formula | C16H24BrClN2O2 |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | tert-butyl N-[2-[(4-bromo-2-chlorophenyl)methylamino]ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCNCc1ccc(Br)cc1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24BrClN2O2/c1-5-20(15(21)22-16(2,3)4)9-8-19-11-12-6-7-13(17)10-14(12)18/h6-7,10,19H,5,8-9,11H2,1-4H3 |
| InChIKey | WIPUWIAJBFGROC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|