C17H26BrFN2O2 — CID 107245720
tert-butyl N-[2-[(5-bromo-2-fluorophenyl)methylamino]ethyl]-N-propan-2-ylcarbamate (PubChem CID 107245720) has the molecular formula C17H26BrFN2O2 and a molecular weight of 389.31 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromo-2-fluorophenyl)methylamino]ethyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[2-[(5-bromo-2-fluorophenyl)methylamino]ethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 107245720 |
| Molecular Formula | C17H26BrFN2O2 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | tert-butyl N-[2-[(5-bromo-2-fluorophenyl)methylamino]ethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCNCc1cc(Br)ccc1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26BrFN2O2/c1-12(2)21(16(22)23-17(3,4)5)9-8-20-11-13-10-14(18)6-7-15(13)19/h6-7,10,12,20H,8-9,11H2,1-5H3 |
| InChIKey | FQZIHDHIHVUOHZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|