C16H26BrN3O2 — CID 107245980
tert-butyl N-[2-[(5-bromo-2-pyridinyl)methylamino]ethyl]-N-propan-2-ylcarbamate (PubChem CID 107245980) has the molecular formula C16H26BrN3O2 and a molecular weight of 372.31 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromo-2-pyridinyl)methylamino]ethyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[2-[(5-bromo-2-pyridinyl)methylamino]ethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 107245980 |
| Molecular Formula | C16H26BrN3O2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | tert-butyl N-[2-[(5-bromo-2-pyridinyl)methylamino]ethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCNCc1ccc(Br)cn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26BrN3O2/c1-12(2)20(15(21)22-16(3,4)5)9-8-18-11-14-7-6-13(17)10-19-14/h6-7,10,12,18H,8-9,11H2,1-5H3 |
| InChIKey | ZKIZQCCRSQMHQZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|