C18H27N3O2 — CID 107245270
tert-butyl N-ethyl-N-[2-(1H-indol-5-ylmethylamino)ethyl]carbamate (PubChem CID 107245270) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-(1H-indol-5-ylmethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-(1H-indol-5-ylmethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107245270 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-(1H-indol-5-ylmethylamino)ethyl]carbamate |
| SMILES | CCN(CCNCc1ccc2[nH]ccc2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27N3O2/c1-5-21(17(22)23-18(2,3)4)11-10-19-13-14-6-7-16-15(12-14)8-9-20-16/h6-9,12,19-20H,5,10-11,13H2,1-4H3 |
| InChIKey | NXFRQOCTJDCBIU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|