C17H28N2O — CID 109019300
3-[(2-methylphenyl)methylamino]-N,N-dipropylpropanamide (PubChem CID 109019300) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-[(2-methylphenyl)methylamino]-N,N-dipropylpropanamide.
| Compound Name | 3-[(2-methylphenyl)methylamino]-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 109019300 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3-[(2-methylphenyl)methylamino]-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCNCc1ccccc1C |
| InChI | InChI=1S/C17H28N2O/c1-4-12-19(13-5-2)17(20)10-11-18-14-16-9-7-6-8-15(16)3/h6-9,18H,4-5,10-14H2,1-3H3 |
| InChIKey | FHDYGPVGWHJFOD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|