C14H22N2O — CID 60695385
N,N-diethyl-2-[(2-methylphenyl)methylamino]acetamide (PubChem CID 60695385) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N,N-diethyl-2-[(2-methylphenyl)methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[(2-methylphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 60695385 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N,N-diethyl-2-[(2-methylphenyl)methylamino]acetamide |
| SMILES | CCN(CC)C(=O)CNCc1ccccc1C |
| InChI | InChI=1S/C14H22N2O/c1-4-16(5-2)14(17)11-15-10-13-9-7-6-8-12(13)3/h6-9,15H,4-5,10-11H2,1-3H3 |
| InChIKey | YILPCWNMYUVHHQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |