C13H20N2O — CID 10857021
2-(benzylamino)-N,N-diethylacetamide (PubChem CID 10857021) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-(benzylamino)-N,N-diethylacetamide.
| Compound Name | 2-(benzylamino)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 10857021 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-(benzylamino)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNCc1ccccc1 |
| InChI | InChI=1S/C13H20N2O/c1-3-15(4-2)13(16)11-14-10-12-8-6-5-7-9-12/h5-9,14H,3-4,10-11H2,1-2H3 |
| InChIKey | XGIIDLHYCUWMKK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |