C14H22N2O4 — CID 103263294
4-[[[3-(diethylamino)-3-oxopropyl]amino]methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103263294) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[[[3-(diethylamino)-3-oxopropyl]amino]methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[[[3-(diethylamino)-3-oxopropyl]amino]methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103263294 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-[[[3-(diethylamino)-3-oxopropyl]amino]methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CCN(CC)C(=O)CCNCc1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C14H22N2O4/c1-4-16(5-2)13(17)6-7-15-9-11-8-12(14(18)19)20-10(11)3/h8,15H,4-7,9H2,1-3H3,(H,18,19) |
| InChIKey | AEGVCNZPWIJSFY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|