C9H14N2O3 — CID 103260997
4-[(2,2-dimethylhydrazinyl)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103260997) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-[(2,2-dimethylhydrazinyl)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(2,2-dimethylhydrazinyl)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103260997 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4-[(2,2-dimethylhydrazinyl)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CNN(C)C |
| InChI | InChI=1S/C9H14N2O3/c1-6-7(5-10-11(2)3)4-8(14-6)9(12)13/h4,10H,5H2,1-3H3,(H,12,13) |
| InChIKey | BPGSBOMWLKDCGE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|