C14H13NO5 — CID 103235066
4-[(1,3-benzodioxol-5-ylamino)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103235066) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 4-[(1,3-benzodioxol-5-ylamino)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(1,3-benzodioxol-5-ylamino)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103235066 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 4-[(1,3-benzodioxol-5-ylamino)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13NO5/c1-8-9(4-13(20-8)14(16)17)6-15-10-2-3-11-12(5-10)19-7-18-11/h2-5,15H,6-7H2,1H3,(H,16,17) |
| InChIKey | PKBBIUGXNHYSMX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|