4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid

C15H17NO3 — CID 103234879

IUPAC4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid
SMILESCc1ccc(C)c(NCc2cc(C(=O)O)oc2C)c1
InChIInChI=1S/C15H17NO3/c1-9-4-5-10(2)13(6-9)16-8-12-7-14(15(17)18)19-11(12)3/h4-7,16H,8H2,1-3H3,(H,17,18)
InChIKeyOWUGNPIVGBMAGU-UHFFFAOYSA-N
MW259.31 g/mol
LogP3.52
Rot. Bonds4

About 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid

4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103234879) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid.

Molecular Properties

Compound Name4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid
PubChem CID103234879
Molecular FormulaC15H17NO3
Molecular Weight259.31 g/mol
Exact Mass259.12
IUPAC Name4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid
SMILESCc1ccc(C)c(NCc2cc(C(=O)O)oc2C)c1
InChIInChI=1S/C15H17NO3/c1-9-4-5-10(2)13(6-9)16-8-12-7-14(15(17)18)19-11(12)3/h4-7,16H,8H2,1-3H3,(H,17,18)
InChIKeyOWUGNPIVGBMAGU-UHFFFAOYSA-N
XLogP3.52
TPSA62.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.31
LogP ≤ 53.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
The IUPAC name of 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid (CID 103234879) is 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid.
What is the SMILES notation for 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
The canonical SMILES for 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid is Cc1ccc(C)c(NCc2cc(C(=O)O)oc2C)c1.
What is the InChIKey of 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
The InChIKey is OWUGNPIVGBMAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-9-4-5-10(2)13(6-9)16-8-12-7-14(15(17)18)19-11(12)3/h4-7,16H,8H2,1-3H3,(H,17,18).
What are the key properties of 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid has a molecular weight of 259.31 g/mol, XLogP of 3.52, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dimethylanilino)methyl]-5-methylfuran-2-carboxylic acid is sourced from PubChem (CID 103234879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).