C14H14BrNO3 — CID 103251369
4-[(3-bromo-4-methylanilino)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103251369) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 4-[(3-bromo-4-methylanilino)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(3-bromo-4-methylanilino)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103251369 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 4-[(3-bromo-4-methylanilino)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1ccc(NCc2cc(C(=O)O)oc2C)cc1Br |
| InChI | InChI=1S/C14H14BrNO3/c1-8-3-4-11(6-12(8)15)16-7-10-5-13(14(17)18)19-9(10)2/h3-6,16H,7H2,1-2H3,(H,17,18) |
| InChIKey | OTHPVLBQUQXELL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |