C13H11BrINO3 — CID 114260642
4-[(4-bromo-3-iodoanilino)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 114260642) has the molecular formula C13H11BrINO3 and a molecular weight of 436.04 g/mol. Its IUPAC name is 4-[(4-bromo-3-iodoanilino)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(4-bromo-3-iodoanilino)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 114260642 |
| Molecular Formula | C13H11BrINO3 |
| Molecular Weight | 436.04 g/mol |
| Exact Mass | 434.90 |
| IUPAC Name | 4-[(4-bromo-3-iodoanilino)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CNc1ccc(Br)c(I)c1 |
| InChI | InChI=1S/C13H11BrINO3/c1-7-8(4-12(19-7)13(17)18)6-16-9-2-3-10(14)11(15)5-9/h2-5,16H,6H2,1H3,(H,17,18) |
| InChIKey | HRDKWUGALAVJBA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.04 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|