4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid

C17H21NO3 — CID 103248273

IUPAC4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid
SMILESCCc1cccc(CC)c1NCc1cc(C(=O)O)oc1C
InChIInChI=1S/C17H21NO3/c1-4-12-7-6-8-13(5-2)16(12)18-10-14-9-15(17(19)20)21-11(14)3/h6-9,18H,4-5,10H2,1-3H3,(H,19,20)
InChIKeyLHWWUFYDLMXPSN-UHFFFAOYSA-N
MW287.36 g/mol
LogP4.02
Rot. Bonds6

About 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid

4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103248273) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid.

Molecular Properties

Compound Name4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid
PubChem CID103248273
Molecular FormulaC17H21NO3
Molecular Weight287.36 g/mol
Exact Mass287.15
IUPAC Name4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid
SMILESCCc1cccc(CC)c1NCc1cc(C(=O)O)oc1C
InChIInChI=1S/C17H21NO3/c1-4-12-7-6-8-13(5-2)16(12)18-10-14-9-15(17(19)20)21-11(14)3/h6-9,18H,4-5,10H2,1-3H3,(H,19,20)
InChIKeyLHWWUFYDLMXPSN-UHFFFAOYSA-N
XLogP4.02
TPSA62.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.36
LogP ≤ 54.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
The IUPAC name of 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid (CID 103248273) is 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid.
What is the SMILES notation for 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
The canonical SMILES for 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid is CCc1cccc(CC)c1NCc1cc(C(=O)O)oc1C.
What is the InChIKey of 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
The InChIKey is LHWWUFYDLMXPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3/c1-4-12-7-6-8-13(5-2)16(12)18-10-14-9-15(17(19)20)21-11(14)3/h6-9,18H,4-5,10H2,1-3H3,(H,19,20).
What are the key properties of 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid?
4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid has a molecular weight of 287.36 g/mol, XLogP of 4.02, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid is sourced from PubChem (CID 103248273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).