C17H21NO3 — CID 103248273
4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103248273) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103248273 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[(2,6-diethylanilino)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CCc1cccc(CC)c1NCc1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C17H21NO3/c1-4-12-7-6-8-13(5-2)16(12)18-10-14-9-15(17(19)20)21-11(14)3/h6-9,18H,4-5,10H2,1-3H3,(H,19,20) |
| InChIKey | LHWWUFYDLMXPSN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |