C18H23N — CID 63492108
2,6-diethyl-N-[(4-methylphenyl)methyl]aniline (PubChem CID 63492108) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 2,6-diethyl-N-[(4-methylphenyl)methyl]aniline.
| Compound Name | 2,6-diethyl-N-[(4-methylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 63492108 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2,6-diethyl-N-[(4-methylphenyl)methyl]aniline |
| SMILES | CCc1cccc(CC)c1NCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H23N/c1-4-16-7-6-8-17(5-2)18(16)19-13-15-11-9-14(3)10-12-15/h6-12,19H,4-5,13H2,1-3H3 |
| InChIKey | IOJDROBGZYWMKY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |