C20H20N2O2 — CID 155941627
3,4-bis[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 155941627) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3,4-bis[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155941627 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3,4-bis[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(CNc2c(NCc3ccc(C)cc3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-13-3-7-15(8-4-13)11-21-17-18(20(24)19(17)23)22-12-16-9-5-14(2)6-10-16/h3-10,21-22H,11-12H2,1-2H3 |
| InChIKey | QARLYXRROLLTLV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|