About 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione
3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 54077577) has the molecular formula C17H21FN2O2
and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
| PubChem CID | 54077577 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(NCc2ccc(F)cc2)c(=O)c1=O)C(C)(C)C |
| InChI | InChI=1S/C17H21FN2O2/c1-10(17(2,3)4)20-14-13(15(21)16(14)22)19-9-11-5-7-12(18)8-6-11/h5-8,10,19-20H,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | MKUQICXHSLXLNU-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione (CID 54077577) is 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione is C[C@@H](Nc1c(NCc2ccc(F)cc2)c(=O)c1=O)C(C)(C)C.
What is the InChIKey of 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione?
The InChIKey is MKUQICXHSLXLNU-SNVBAGLBSA-N. The full InChI is InChI=1S/C17H21FN2O2/c1-10(17(2,3)4)20-14-13(15(21)16(14)22)19-9-11-5-7-12(18)8-6-11/h5-8,10,19-20H,9H2,1-4H3/t10-/m1/s1.
What are the key properties of 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione?
3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione has a molecular weight of 304.36 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 54077577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).