C17H21FN2O2 — CID 54077577
3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 54077577) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 54077577 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-[[(2R)-3,3-dimethylbutan-2-yl]amino]-4-[(4-fluorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(NCc2ccc(F)cc2)c(=O)c1=O)C(C)(C)C |
| InChI | InChI=1S/C17H21FN2O2/c1-10(17(2,3)4)20-14-13(15(21)16(14)22)19-9-11-5-7-12(18)8-6-11/h5-8,10,19-20H,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | MKUQICXHSLXLNU-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|