C19H15NO4 — CID 22550260
3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 22550260) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 22550260 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(-c2c(NCc3ccc4c(c3)OCO4)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C19H15NO4/c1-11-2-5-13(6-3-11)16-17(19(22)18(16)21)20-9-12-4-7-14-15(8-12)24-10-23-14/h2-8,20H,9-10H2,1H3 |
| InChIKey | YLJMTGGEUOMZAK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|