C19H15ClN2O4 — CID 86207063
3-(1,3-benzodioxol-5-ylmethylamino)-4-[(3-chlorophenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 86207063) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-4-[(3-chlorophenyl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-[(3-chlorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 86207063 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-[(3-chlorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2cccc(Cl)c2)c(NCc2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C19H15ClN2O4/c20-13-3-1-2-11(6-13)8-21-16-17(19(24)18(16)23)22-9-12-4-5-14-15(7-12)26-10-25-14/h1-7,21-22H,8-10H2 |
| InChIKey | PEKZMHATBZWSIE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|